C35H24N6O2S — CID 138756659
N-[4-(4-nitrophenyl)-1,3-diphenylpyrazol-5-yl]-3,5-diphenyl-1,3,4-thiadiazol-2-imine (PubChem CID 138756659) has the molecular formula C35H24N6O2S and a molecular weight of 592.68 g/mol. Its IUPAC name is N-[4-(4-nitrophenyl)-1,3-diphenylpyrazol-5-yl]-3,5-diphenyl-1,3,4-thiadiazol-2-imine.
| Compound Name | N-[4-(4-nitrophenyl)-1,3-diphenylpyrazol-5-yl]-3,5-diphenyl-1,3,4-thiadiazol-2-imine |
|---|---|
| PubChem CID | 138756659 |
| Molecular Formula | C35H24N6O2S |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | N-[4-(4-nitrophenyl)-1,3-diphenylpyrazol-5-yl]-3,5-diphenyl-1,3,4-thiadiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccc(-c2c(-c3ccccc3)nn(-c3ccccc3)c2N=c2sc(-c3ccccc3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H24N6O2S/c42-41(43)30-23-21-25(22-24-30)31-32(26-13-5-1-6-14-26)37-39(28-17-9-3-10-18-28)33(31)36-35-40(29-19-11-4-12-20-29)38-34(44-35)27-15-7-2-8-16-27/h1-24H |
| InChIKey | ZVAMDTLLPFUCDE-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|