C27H23N7O2S — CID 164608703
N-[1-[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]ethylideneamino]-3,5-diphenyl-1,3,4-thiadiazol-2-imine (PubChem CID 164608703) has the molecular formula C27H23N7O2S and a molecular weight of 509.60 g/mol. Its IUPAC name is N-[1-[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]ethylideneamino]-3,5-diphenyl-1,3,4-thiadiazol-2-imine.
| Compound Name | N-[1-[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]ethylideneamino]-3,5-diphenyl-1,3,4-thiadiazol-2-imine |
|---|---|
| PubChem CID | 164608703 |
| Molecular Formula | C27H23N7O2S |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-[1-[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]ethylideneamino]-3,5-diphenyl-1,3,4-thiadiazol-2-imine |
| SMILES | CC(=NN=c1sc(-c2ccccc2)nn1-c1ccccc1)c1c(C)nn(-c2ccc([N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C27H23N7O2S/c1-18(25-19(2)30-32(20(25)3)23-14-16-24(17-15-23)34(35)36)28-29-27-33(22-12-8-5-9-13-22)31-26(37-27)21-10-6-4-7-11-21/h4-17H,1-3H3 |
| InChIKey | VXNYKSOHOBJVCQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 103.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|