C16H16FNO — CID 138756946
3-[(4-fluorophenyl)methyl]-5-phenyl-1,3-oxazolidine (PubChem CID 138756946) has the molecular formula C16H16FNO and a molecular weight of 257.31 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-5-phenyl-1,3-oxazolidine.
| Compound Name | 3-[(4-fluorophenyl)methyl]-5-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 138756946 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-5-phenyl-1,3-oxazolidine |
| SMILES | Fc1ccc(CN2COC(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C16H16FNO/c17-15-8-6-13(7-9-15)10-18-11-16(19-12-18)14-4-2-1-3-5-14/h1-9,16H,10-12H2 |
| InChIKey | CUJFCNNYIRFXDO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |