C32H25N5O2S — CID 138757279
2-[[5-[4-[bis(1H-indol-3-yl)methyl]phenyl]-1,3,4-thiadiazol-2-yl]amino]-4-methoxyphenol (PubChem CID 138757279) has the molecular formula C32H25N5O2S and a molecular weight of 543.65 g/mol. Its IUPAC name is 2-[[5-[4-[bis(1H-indol-3-yl)methyl]phenyl]-1,3,4-thiadiazol-2-yl]amino]-4-methoxyphenol.
| Compound Name | 2-[[5-[4-[bis(1H-indol-3-yl)methyl]phenyl]-1,3,4-thiadiazol-2-yl]amino]-4-methoxyphenol |
|---|---|
| PubChem CID | 138757279 |
| Molecular Formula | C32H25N5O2S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | 2-[[5-[4-[bis(1H-indol-3-yl)methyl]phenyl]-1,3,4-thiadiazol-2-yl]amino]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(Nc2nnc(-c3ccc(C(c4c[nH]c5ccccc45)c4c[nH]c5ccccc45)cc3)s2)c1 |
| InChI | InChI=1S/C32H25N5O2S/c1-39-21-14-15-29(38)28(16-21)35-32-37-36-31(40-32)20-12-10-19(11-13-20)30(24-17-33-26-8-4-2-6-22(24)26)25-18-34-27-9-5-3-7-23(25)27/h2-18,30,33-34,38H,1H3,(H,35,37) |
| InChIKey | GCGCNLOZIFPWJE-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|