C14H11FN4O6S — CID 138805657
3,5-dinitrobenzoic acid;(4-fluorophenyl) carbamimidothioate (PubChem CID 138805657) has the molecular formula C14H11FN4O6S and a molecular weight of 382.33 g/mol. Its IUPAC name is 3,5-dinitrobenzoic acid;(4-fluorophenyl) carbamimidothioate.
| Compound Name | 3,5-dinitrobenzoic acid;(4-fluorophenyl) carbamimidothioate |
|---|---|
| PubChem CID | 138805657 |
| Molecular Formula | C14H11FN4O6S |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 3,5-dinitrobenzoic acid;(4-fluorophenyl) carbamimidothioate |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.[H]/N=C(\N)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C7H7FN2S.C7H4N2O6/c8-5-1-3-6(4-2-5)11-7(9)10;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-4H,(H3,9,10);1-3H,(H,10,11) |
| InChIKey | RYKBLLPQHKKZLR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 173.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|