C14H18FNO4 — CID 138809934
4-[2-(4-fluorophenoxy)ethyl]-1,4-oxazepane-6-carboxylic acid (PubChem CID 138809934) has the molecular formula C14H18FNO4 and a molecular weight of 283.30 g/mol. Its IUPAC name is 4-[2-(4-fluorophenoxy)ethyl]-1,4-oxazepane-6-carboxylic acid.
| Compound Name | 4-[2-(4-fluorophenoxy)ethyl]-1,4-oxazepane-6-carboxylic acid |
|---|---|
| PubChem CID | 138809934 |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-[2-(4-fluorophenoxy)ethyl]-1,4-oxazepane-6-carboxylic acid |
| SMILES | O=C(O)C1COCCN(CCOc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C14H18FNO4/c15-12-1-3-13(4-2-12)20-8-6-16-5-7-19-10-11(9-16)14(17)18/h1-4,11H,5-10H2,(H,17,18) |
| InChIKey | JLJFPFNGICLSEV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |