C15H21N3O4 — CID 138810204
[(3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(3-morpholin-4-yl-1,2-oxazol-5-yl)methanone (PubChem CID 138810204) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is [(3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(3-morpholin-4-yl-1,2-oxazol-5-yl)methanone.
| Compound Name | [(3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(3-morpholin-4-yl-1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 138810204 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | [(3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(3-morpholin-4-yl-1,2-oxazol-5-yl)methanone |
| SMILES | O=C(c1cc(N2CCOCC2)no1)N1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C15H21N3O4/c19-12-5-10-8-18(9-11(10)6-12)15(20)13-7-14(16-22-13)17-1-3-21-4-2-17/h7,10-12,19H,1-6,8-9H2/t10-,11+,12? |
| InChIKey | OSTYURSZXAJTDQ-FOSCPWQOSA-N |
| XLogP | 0.35 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |