C18H23N3O6S2Si — CID 138857336
ethyl 2-[2-oxo-2-[2-[(2-trimethylsilylethoxycarbonylamino)methyl]-1,3-thiazol-4-yl]acetyl]-1,3-thiazole-4-carboxylate (PubChem CID 138857336) has the molecular formula C18H23N3O6S2Si and a molecular weight of 469.62 g/mol. Its IUPAC name is ethyl 2-[2-oxo-2-[2-[(2-trimethylsilylethoxycarbonylamino)methyl]-1,3-thiazol-4-yl]acetyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[2-oxo-2-[2-[(2-trimethylsilylethoxycarbonylamino)methyl]-1,3-thiazol-4-yl]acetyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 138857336 |
| Molecular Formula | C18H23N3O6S2Si |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | ethyl 2-[2-oxo-2-[2-[(2-trimethylsilylethoxycarbonylamino)methyl]-1,3-thiazol-4-yl]acetyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C(=O)C(=O)c2csc(CNC(=O)OCC[Si](C)(C)C)n2)n1 |
| InChI | InChI=1S/C18H23N3O6S2Si/c1-5-26-17(24)12-10-29-16(21-12)15(23)14(22)11-9-28-13(20-11)8-19-18(25)27-6-7-30(2,3)4/h9-10H,5-8H2,1-4H3,(H,19,25) |
| InChIKey | VLPYZYKDQDSJRW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|