C18H26N6O5S2Si — CID 138857348
ethyl 2-[1-azido-2-hydroxy-2-[2-[(2-trimethylsilylethoxycarbonylamino)methyl]-1,3-thiazol-4-yl]ethyl]-1,3-thiazole-4-carboxylate (PubChem CID 138857348) has the molecular formula C18H26N6O5S2Si and a molecular weight of 498.66 g/mol. Its IUPAC name is ethyl 2-[1-azido-2-hydroxy-2-[2-[(2-trimethylsilylethoxycarbonylamino)methyl]-1,3-thiazol-4-yl]ethyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[1-azido-2-hydroxy-2-[2-[(2-trimethylsilylethoxycarbonylamino)methyl]-1,3-thiazol-4-yl]ethyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 138857348 |
| Molecular Formula | C18H26N6O5S2Si |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | ethyl 2-[1-azido-2-hydroxy-2-[2-[(2-trimethylsilylethoxycarbonylamino)methyl]-1,3-thiazol-4-yl]ethyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C(N=[N+]=[N-])C(O)c2csc(CNC(=O)OCC[Si](C)(C)C)n2)n1 |
| InChI | InChI=1S/C18H26N6O5S2Si/c1-5-28-17(26)12-10-31-16(22-12)14(23-24-19)15(25)11-9-30-13(21-11)8-20-18(27)29-6-7-32(2,3)4/h9-10,14-15,25H,5-8H2,1-4H3,(H,20,27) |
| InChIKey | CFMHWVDKORHIEL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 159.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|