C16H20N6O5S2 — CID 138857345
methyl 2-[1-azido-2-hydroxy-2-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazol-4-yl]ethyl]-1,3-thiazole-4-carboxylate (PubChem CID 138857345) has the molecular formula C16H20N6O5S2 and a molecular weight of 440.51 g/mol. Its IUPAC name is methyl 2-[1-azido-2-hydroxy-2-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazol-4-yl]ethyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[1-azido-2-hydroxy-2-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazol-4-yl]ethyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 138857345 |
| Molecular Formula | C16H20N6O5S2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | methyl 2-[1-azido-2-hydroxy-2-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazol-4-yl]ethyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(C(N=[N+]=[N-])C(O)c2csc(CNC(=O)OC(C)(C)C)n2)n1 |
| InChI | InChI=1S/C16H20N6O5S2/c1-16(2,3)27-15(25)18-5-10-19-8(6-28-10)12(23)11(21-22-17)13-20-9(7-29-13)14(24)26-4/h6-7,11-12,23H,5H2,1-4H3,(H,18,25) |
| InChIKey | OXKVSZXHTRYEIR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 159.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|