C22H27N7O7S2 — CID 138857338
methyl 2-[1-azido-2-hydroxy-2-[2-[[[3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]-3-oxopropanoyl]amino]methyl]-1,3-thiazol-4-yl]ethyl]-1,3-thiazole-4-carboxylate (PubChem CID 138857338) has the molecular formula C22H27N7O7S2 and a molecular weight of 565.63 g/mol. Its IUPAC name is methyl 2-[1-azido-2-hydroxy-2-[2-[[[3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]-3-oxopropanoyl]amino]methyl]-1,3-thiazol-4-yl]ethyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[1-azido-2-hydroxy-2-[2-[[[3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]-3-oxopropanoyl]amino]methyl]-1,3-thiazol-4-yl]ethyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 138857338 |
| Molecular Formula | C22H27N7O7S2 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | methyl 2-[1-azido-2-hydroxy-2-[2-[[[3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]-3-oxopropanoyl]amino]methyl]-1,3-thiazol-4-yl]ethyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(C(N=[N+]=[N-])C(O)c2csc(CNC(=O)CC(=O)C3(NC(=O)OC(C)(C)C)CC3)n2)n1 |
| InChI | InChI=1S/C22H27N7O7S2/c1-21(2,3)36-20(34)27-22(5-6-22)13(30)7-14(31)24-8-15-25-11(9-37-15)17(32)16(28-29-23)18-26-12(10-38-18)19(33)35-4/h9-10,16-17,32H,5-8H2,1-4H3,(H,24,31)(H,27,34) |
| InChIKey | PFFXMUBXCMWOSG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 205.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|