C16H18ClN7O5S2 — CID 138857341
[1-[3-[[4-[2-azido-2-(4-carboxy-1,3-thiazol-2-yl)-1-hydroxyethyl]-1,3-thiazol-2-yl]methylamino]-3-oxopropanoyl]cyclopropyl]azanium chloride (PubChem CID 138857341) has the molecular formula C16H18ClN7O5S2 and a molecular weight of 487.95 g/mol. Its IUPAC name is [1-[3-[[4-[2-azido-2-(4-carboxy-1,3-thiazol-2-yl)-1-hydroxyethyl]-1,3-thiazol-2-yl]methylamino]-3-oxopropanoyl]cyclopropyl]azanium chloride.
| Compound Name | [1-[3-[[4-[2-azido-2-(4-carboxy-1,3-thiazol-2-yl)-1-hydroxyethyl]-1,3-thiazol-2-yl]methylamino]-3-oxopropanoyl]cyclopropyl]azanium chloride |
|---|---|
| PubChem CID | 138857341 |
| Molecular Formula | C16H18ClN7O5S2 |
| Molecular Weight | 487.95 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | [1-[3-[[4-[2-azido-2-(4-carboxy-1,3-thiazol-2-yl)-1-hydroxyethyl]-1,3-thiazol-2-yl]methylamino]-3-oxopropanoyl]cyclopropyl]azanium chloride |
| SMILES | [Cl-].[N-]=[N+]=NC(c1nc(C(=O)O)cs1)C(O)c1csc(CNC(=O)CC(=O)C2([NH3+])CC2)n1 |
| InChI | InChI=1S/C16H17N7O5S2.ClH/c17-16(1-2-16)9(24)3-10(25)19-4-11-20-7(5-29-11)13(26)12(22-23-18)14-21-8(6-30-14)15(27)28;/h5-6,12-13,26H,1-4,17H2,(H,19,25)(H,27,28);1H |
| InChIKey | DJAFDPQDUDSVKV-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 205.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.95 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|