C11H13ClN6O3S2 — CID 138857355
[4-[2-azido-1-hydroxy-2-(4-methoxycarbonyl-1,3-thiazol-2-yl)ethyl]-1,3-thiazol-2-yl]methylazanium chloride (PubChem CID 138857355) has the molecular formula C11H13ClN6O3S2 and a molecular weight of 376.85 g/mol. Its IUPAC name is [4-[2-azido-1-hydroxy-2-(4-methoxycarbonyl-1,3-thiazol-2-yl)ethyl]-1,3-thiazol-2-yl]methylazanium chloride.
| Compound Name | [4-[2-azido-1-hydroxy-2-(4-methoxycarbonyl-1,3-thiazol-2-yl)ethyl]-1,3-thiazol-2-yl]methylazanium chloride |
|---|---|
| PubChem CID | 138857355 |
| Molecular Formula | C11H13ClN6O3S2 |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | [4-[2-azido-1-hydroxy-2-(4-methoxycarbonyl-1,3-thiazol-2-yl)ethyl]-1,3-thiazol-2-yl]methylazanium chloride |
| SMILES | COC(=O)c1csc(C(N=[N+]=[N-])C(O)c2csc(C[NH3+])n2)n1.[Cl-] |
| InChI | InChI=1S/C11H12N6O3S2.ClH/c1-20-11(19)6-4-22-10(15-6)8(16-17-13)9(18)5-3-21-7(2-12)14-5;/h3-4,8-9,18H,2,12H2,1H3;1H |
| InChIKey | HRSQWSMQKJWYHQ-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|