C11H12N6O3S2 — CID 138857334
methyl 2-[2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-azido-2-hydroxyethyl]-1,3-thiazole-4-carboxylate (PubChem CID 138857334) has the molecular formula C11H12N6O3S2 and a molecular weight of 340.39 g/mol. Its IUPAC name is methyl 2-[2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-azido-2-hydroxyethyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-azido-2-hydroxyethyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 138857334 |
| Molecular Formula | C11H12N6O3S2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | methyl 2-[2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-azido-2-hydroxyethyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(C(N=[N+]=[N-])C(O)c2csc(CN)n2)n1 |
| InChI | InChI=1S/C11H12N6O3S2/c1-20-11(19)6-4-22-10(15-6)8(16-17-13)9(18)5-3-21-7(2-12)14-5/h3-4,8-9,18H,2,12H2,1H3 |
| InChIKey | BPTAXUPTHBUCTR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 147.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|