C23H24N6O2 — CID 1389123
2-amino-1-[(3-hydroxyphenyl)methylideneamino]-N-(3-methylbutyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 1389123) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 2-amino-1-[(3-hydroxyphenyl)methylideneamino]-N-(3-methylbutyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-1-[(3-hydroxyphenyl)methylideneamino]-N-(3-methylbutyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 1389123 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-amino-1-[(3-hydroxyphenyl)methylideneamino]-N-(3-methylbutyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | CC(C)CCNC(=O)c1c(N)n(N=Cc2cccc(O)c2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C23H24N6O2/c1-14(2)10-11-25-23(31)19-20-22(28-18-9-4-3-8-17(18)27-20)29(21(19)24)26-13-15-6-5-7-16(30)12-15/h3-9,12-14,30H,10-11,24H2,1-2H3,(H,25,31) |
| InChIKey | DTFCAGHVHLXPTI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|