C23H23BrN6O2 — CID 136846318
2-amino-1-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-N-(3-methylbutyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 136846318) has the molecular formula C23H23BrN6O2 and a molecular weight of 495.38 g/mol. Its IUPAC name is 2-amino-1-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-N-(3-methylbutyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-1-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-N-(3-methylbutyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 136846318 |
| Molecular Formula | C23H23BrN6O2 |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 2-amino-1-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-N-(3-methylbutyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | CC(C)CCNC(=O)c1c(N)n(/N=C\c2cc(Br)ccc2O)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C23H23BrN6O2/c1-13(2)9-10-26-23(32)19-20-22(29-17-6-4-3-5-16(17)28-20)30(21(19)25)27-12-14-11-15(24)7-8-18(14)31/h3-8,11-13,31H,9-10,25H2,1-2H3,(H,26,32)/b27-12- |
| InChIKey | TXCVFADHVJDSFN-PPDIBHTLSA-N |
| XLogP | 4.29 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|