C26H22N6O2 — CID 135649133
2-amino-N-(3,5-dimethylphenyl)-1-[(E)-(2-hydroxyphenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 135649133) has the molecular formula C26H22N6O2 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-amino-N-(3,5-dimethylphenyl)-1-[(E)-(2-hydroxyphenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-N-(3,5-dimethylphenyl)-1-[(E)-(2-hydroxyphenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 135649133 |
| Molecular Formula | C26H22N6O2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-amino-N-(3,5-dimethylphenyl)-1-[(E)-(2-hydroxyphenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2c(N)n(/N=C/c3ccccc3O)c3nc4ccccc4nc23)c1 |
| InChI | InChI=1S/C26H22N6O2/c1-15-11-16(2)13-18(12-15)29-26(34)22-23-25(31-20-9-5-4-8-19(20)30-23)32(24(22)27)28-14-17-7-3-6-10-21(17)33/h3-14,33H,27H2,1-2H3,(H,29,34)/b28-14+ |
| InChIKey | LJZAWWKMSHSYFG-CCVNUDIWSA-N |
| XLogP | 4.62 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|