C24H18N6O — CID 6888349
2-amino-1-[(E)-benzylideneamino]-N-phenylpyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 6888349) has the molecular formula C24H18N6O and a molecular weight of 406.45 g/mol. Its IUPAC name is 2-amino-1-[(E)-benzylideneamino]-N-phenylpyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-1-[(E)-benzylideneamino]-N-phenylpyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 6888349 |
| Molecular Formula | C24H18N6O |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-amino-1-[(E)-benzylideneamino]-N-phenylpyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | Nc1c(C(=O)Nc2ccccc2)c2nc3ccccc3nc2n1/N=C/c1ccccc1 |
| InChI | InChI=1S/C24H18N6O/c25-22-20(24(31)27-17-11-5-2-6-12-17)21-23(29-19-14-8-7-13-18(19)28-21)30(22)26-15-16-9-3-1-4-10-16/h1-15H,25H2,(H,27,31)/b26-15+ |
| InChIKey | NPSDXTICHXMVRW-CVKSISIWSA-N |
| XLogP | 4.30 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|