C25H19N7O3 — CID 6868643
2-amino-N-(4-methylphenyl)-1-[(E)-(3-nitrophenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 6868643) has the molecular formula C25H19N7O3 and a molecular weight of 465.47 g/mol. Its IUPAC name is 2-amino-N-(4-methylphenyl)-1-[(E)-(3-nitrophenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-N-(4-methylphenyl)-1-[(E)-(3-nitrophenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 6868643 |
| Molecular Formula | C25H19N7O3 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-amino-N-(4-methylphenyl)-1-[(E)-(3-nitrophenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(N)n(/N=C/c3cccc([N+](=O)[O-])c3)c3nc4ccccc4nc23)cc1 |
| InChI | InChI=1S/C25H19N7O3/c1-15-9-11-17(12-10-15)28-25(33)21-22-24(30-20-8-3-2-7-19(20)29-22)31(23(21)26)27-14-16-5-4-6-18(13-16)32(34)35/h2-14H,26H2,1H3,(H,28,33)/b27-14+ |
| InChIKey | RFYKJKBEMDZNPK-MZJWZYIUSA-N |
| XLogP | 4.52 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|