C26H21N7O4 — CID 6881081
2-amino-N-[(4-methoxyphenyl)methyl]-1-[(E)-(3-nitrophenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 6881081) has the molecular formula C26H21N7O4 and a molecular weight of 495.50 g/mol. Its IUPAC name is 2-amino-N-[(4-methoxyphenyl)methyl]-1-[(E)-(3-nitrophenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-N-[(4-methoxyphenyl)methyl]-1-[(E)-(3-nitrophenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 6881081 |
| Molecular Formula | C26H21N7O4 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 2-amino-N-[(4-methoxyphenyl)methyl]-1-[(E)-(3-nitrophenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2c(N)n(/N=C/c3cccc([N+](=O)[O-])c3)c3nc4ccccc4nc23)cc1 |
| InChI | InChI=1S/C26H21N7O4/c1-37-19-11-9-16(10-12-19)14-28-26(34)22-23-25(31-21-8-3-2-7-20(21)30-23)32(24(22)27)29-15-17-5-4-6-18(13-17)33(35)36/h2-13,15H,14,27H2,1H3,(H,28,34)/b29-15+ |
| InChIKey | XIBFWLKTOLQUCD-WKULSOCRSA-N |
| XLogP | 3.90 |
| TPSA | 150.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|