C24H26N6O — CID 3806719
2-amino-1-[(4-methylphenyl)methylideneamino]-N-pentylpyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 3806719) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-amino-1-[(4-methylphenyl)methylideneamino]-N-pentylpyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-1-[(4-methylphenyl)methylideneamino]-N-pentylpyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 3806719 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-amino-1-[(4-methylphenyl)methylideneamino]-N-pentylpyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | CCCCCNC(=O)c1c(N)n(N=Cc2ccc(C)cc2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C24H26N6O/c1-3-4-7-14-26-24(31)20-21-23(29-19-9-6-5-8-18(19)28-21)30(22(20)25)27-15-17-12-10-16(2)11-13-17/h5-6,8-13,15H,3-4,7,14,25H2,1-2H3,(H,26,31) |
| InChIKey | ZFDTYYZPPDBYEE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|