C23H22N6O4 — CID 6184070
methyl 4-[(Z)-[2-amino-3-(2-methoxyethylcarbamoyl)pyrrolo[3,2-b]quinoxalin-1-yl]iminomethyl]benzoate (PubChem CID 6184070) has the molecular formula C23H22N6O4 and a molecular weight of 446.47 g/mol. Its IUPAC name is methyl 4-[(Z)-[2-amino-3-(2-methoxyethylcarbamoyl)pyrrolo[3,2-b]quinoxalin-1-yl]iminomethyl]benzoate.
| Compound Name | methyl 4-[(Z)-[2-amino-3-(2-methoxyethylcarbamoyl)pyrrolo[3,2-b]quinoxalin-1-yl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 6184070 |
| Molecular Formula | C23H22N6O4 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | methyl 4-[(Z)-[2-amino-3-(2-methoxyethylcarbamoyl)pyrrolo[3,2-b]quinoxalin-1-yl]iminomethyl]benzoate |
| SMILES | COCCNC(=O)c1c(N)n(/N=C\c2ccc(C(=O)OC)cc2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C23H22N6O4/c1-32-12-11-25-22(30)18-19-21(28-17-6-4-3-5-16(17)27-19)29(20(18)24)26-13-14-7-9-15(10-8-14)23(31)33-2/h3-10,13H,11-12,24H2,1-2H3,(H,25,30)/b26-13- |
| InChIKey | BRSYXKUBPQALGT-ZMFRSBBQSA-N |
| XLogP | 2.21 |
| TPSA | 133.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|