C30H30N6O — CID 6887656
2-amino-N-(3-phenylpropyl)-1-[(E)-(4-propan-2-ylphenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 6887656) has the molecular formula C30H30N6O and a molecular weight of 490.61 g/mol. Its IUPAC name is 2-amino-N-(3-phenylpropyl)-1-[(E)-(4-propan-2-ylphenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-N-(3-phenylpropyl)-1-[(E)-(4-propan-2-ylphenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 6887656 |
| Molecular Formula | C30H30N6O |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 2-amino-N-(3-phenylpropyl)-1-[(E)-(4-propan-2-ylphenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | CC(C)c1ccc(/C=N/n2c(N)c(C(=O)NCCCc3ccccc3)c3nc4ccccc4nc32)cc1 |
| InChI | InChI=1S/C30H30N6O/c1-20(2)23-16-14-22(15-17-23)19-33-36-28(31)26(27-29(36)35-25-13-7-6-12-24(25)34-27)30(37)32-18-8-11-21-9-4-3-5-10-21/h3-7,9-10,12-17,19-20H,8,11,18,31H2,1-2H3,(H,32,37)/b33-19+ |
| InChIKey | QXCHZWRQBDGWJH-HNSNBQBZSA-N |
| XLogP | 5.53 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|