C25H19BrN6O2 — CID 136841966
2-amino-N-benzyl-1-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 136841966) has the molecular formula C25H19BrN6O2 and a molecular weight of 515.37 g/mol. Its IUPAC name is 2-amino-N-benzyl-1-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-N-benzyl-1-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 136841966 |
| Molecular Formula | C25H19BrN6O2 |
| Molecular Weight | 515.37 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | 2-amino-N-benzyl-1-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | Nc1c(C(=O)NCc2ccccc2)c2nc3ccccc3nc2n1/N=C\c1cc(Br)ccc1O |
| InChI | InChI=1S/C25H19BrN6O2/c26-17-10-11-20(33)16(12-17)14-29-32-23(27)21(25(34)28-13-15-6-2-1-3-7-15)22-24(32)31-19-9-5-4-8-18(19)30-22/h1-12,14,33H,13,27H2,(H,28,34)/b29-14- |
| InChIKey | OEARTUAVZGYGNT-NUJZUDFISA-N |
| XLogP | 4.45 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|