C26H21BrN6O2 — CID 135649117
2-amino-1-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-N-(2-phenylethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 135649117) has the molecular formula C26H21BrN6O2 and a molecular weight of 529.40 g/mol. Its IUPAC name is 2-amino-1-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-N-(2-phenylethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-1-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-N-(2-phenylethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 135649117 |
| Molecular Formula | C26H21BrN6O2 |
| Molecular Weight | 529.40 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | 2-amino-1-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-N-(2-phenylethyl)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | Nc1c(C(=O)NCCc2ccccc2)c2nc3ccccc3nc2n1/N=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C26H21BrN6O2/c27-18-10-11-21(34)17(14-18)15-30-33-24(28)22(26(35)29-13-12-16-6-2-1-3-7-16)23-25(33)32-20-9-5-4-8-19(20)31-23/h1-11,14-15,34H,12-13,28H2,(H,29,35)/b30-15+ |
| InChIKey | FXJNKWUFPZIPKF-FJEPWZHXSA-N |
| XLogP | 4.49 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|