C24H30FNO3 — CID 138959643
1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol (PubChem CID 138959643) has the molecular formula C24H30FNO3 and a molecular weight of 399.51 g/mol. Its IUPAC name is 1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol.
| Compound Name | 1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 138959643 |
| Molecular Formula | C24H30FNO3 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol |
| SMILES | C=CCc1ccccc1OCC(O)CN1CCC(C(O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H30FNO3/c1-2-5-18-6-3-4-7-23(18)29-17-22(27)16-26-14-12-20(13-15-26)24(28)19-8-10-21(25)11-9-19/h2-4,6-11,20,22,24,27-28H,1,5,12-17H2 |
| InChIKey | DWRNNLMKJPQYDY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|