C22H27FN2OS — CID 3401114
1-[4-(4-fluorophenyl)piperazin-1-yl]-3-(2-prop-2-enylphenoxy)propane-2-thiol (PubChem CID 3401114) has the molecular formula C22H27FN2OS and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)piperazin-1-yl]-3-(2-prop-2-enylphenoxy)propane-2-thiol.
| Compound Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-3-(2-prop-2-enylphenoxy)propane-2-thiol |
|---|---|
| PubChem CID | 3401114 |
| Molecular Formula | C22H27FN2OS |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-3-(2-prop-2-enylphenoxy)propane-2-thiol |
| SMILES | C=CCc1ccccc1OCC(S)CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H27FN2OS/c1-2-5-18-6-3-4-7-22(18)26-17-21(27)16-24-12-14-25(15-13-24)20-10-8-19(23)9-11-20/h2-4,6-11,21,27H,1,5,12-17H2 |
| InChIKey | AZYGVVDETYHQBH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|