C23H30N2OS — CID 92764384
(2S)-1-(4-benzylpiperazin-1-yl)-3-(2-prop-2-enylphenoxy)propane-2-thiol (PubChem CID 92764384) has the molecular formula C23H30N2OS and a molecular weight of 382.57 g/mol. Its IUPAC name is (2S)-1-(4-benzylpiperazin-1-yl)-3-(2-prop-2-enylphenoxy)propane-2-thiol.
| Compound Name | (2S)-1-(4-benzylpiperazin-1-yl)-3-(2-prop-2-enylphenoxy)propane-2-thiol |
|---|---|
| PubChem CID | 92764384 |
| Molecular Formula | C23H30N2OS |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (2S)-1-(4-benzylpiperazin-1-yl)-3-(2-prop-2-enylphenoxy)propane-2-thiol |
| SMILES | C=CCc1ccccc1OC[C@@H](S)CN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N2OS/c1-2-8-21-11-6-7-12-23(21)26-19-22(27)18-25-15-13-24(14-16-25)17-20-9-4-3-5-10-20/h2-7,9-12,22,27H,1,8,13-19H2/t22-/m0/s1 |
| InChIKey | ABEOVEOPJGXRFJ-QFIPXVFZSA-N |
| XLogP | 3.91 |
| TPSA | 15.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|