C20H22N4O2S — CID 55435964
1-(1-benzyltetrazol-5-yl)sulfanyl-3-(2-prop-2-enylphenoxy)propan-2-ol (PubChem CID 55435964) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-(1-benzyltetrazol-5-yl)sulfanyl-3-(2-prop-2-enylphenoxy)propan-2-ol.
| Compound Name | 1-(1-benzyltetrazol-5-yl)sulfanyl-3-(2-prop-2-enylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 55435964 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-(1-benzyltetrazol-5-yl)sulfanyl-3-(2-prop-2-enylphenoxy)propan-2-ol |
| SMILES | C=CCc1ccccc1OCC(O)CSc1nnnn1Cc1ccccc1 |
| InChI | InChI=1S/C20H22N4O2S/c1-2-8-17-11-6-7-12-19(17)26-14-18(25)15-27-20-21-22-23-24(20)13-16-9-4-3-5-10-16/h2-7,9-12,18,25H,1,8,13-15H2 |
| InChIKey | PKAFZYBBJVHKQS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|