C26H34N2O2 — CID 138960310
1-(2-tert-butyl-4-methylphenoxy)-3-(2-cyclopentylbenzimidazol-1-yl)propan-2-ol (PubChem CID 138960310) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 1-(2-tert-butyl-4-methylphenoxy)-3-(2-cyclopentylbenzimidazol-1-yl)propan-2-ol.
| Compound Name | 1-(2-tert-butyl-4-methylphenoxy)-3-(2-cyclopentylbenzimidazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 138960310 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 1-(2-tert-butyl-4-methylphenoxy)-3-(2-cyclopentylbenzimidazol-1-yl)propan-2-ol |
| SMILES | Cc1ccc(OCC(O)Cn2c(C3CCCC3)nc3ccccc32)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H34N2O2/c1-18-13-14-24(21(15-18)26(2,3)4)30-17-20(29)16-28-23-12-8-7-11-22(23)27-25(28)19-9-5-6-10-19/h7-8,11-15,19-20,29H,5-6,9-10,16-17H2,1-4H3 |
| InChIKey | AWZDQRHNPTVWBV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |