C14H15NO3 — CID 138963409
1-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl acetate (PubChem CID 138963409) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 1-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl acetate.
| Compound Name | 1-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl acetate |
|---|---|
| PubChem CID | 138963409 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl acetate |
| SMILES | CC(=O)OC(C)c1nc(-c2ccccc2)oc1C |
| InChI | InChI=1S/C14H15NO3/c1-9(17-11(3)16)13-10(2)18-14(15-13)12-7-5-4-6-8-12/h4-9H,1-3H3 |
| InChIKey | ZZGPHZNTXBHUEQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |