C34H39NO3 — CID 138964508
methyl (2S)-3-(dibenzylamino)-2-phenyl-2-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methoxy]propanoate (PubChem CID 138964508) has the molecular formula C34H39NO3 and a molecular weight of 509.69 g/mol. Its IUPAC name is methyl (2S)-3-(dibenzylamino)-2-phenyl-2-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methoxy]propanoate.
| Compound Name | methyl (2S)-3-(dibenzylamino)-2-phenyl-2-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methoxy]propanoate |
|---|---|
| PubChem CID | 138964508 |
| Molecular Formula | C34H39NO3 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | methyl (2S)-3-(dibenzylamino)-2-phenyl-2-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methoxy]propanoate |
| SMILES | C=C(C)[C@@H]1CC=C(CO[C@@](CN(Cc2ccccc2)Cc2ccccc2)(C(=O)OC)c2ccccc2)CC1 |
| InChI | InChI=1S/C34H39NO3/c1-27(2)31-21-19-30(20-22-31)25-38-34(33(36)37-3,32-17-11-6-12-18-32)26-35(23-28-13-7-4-8-14-28)24-29-15-9-5-10-16-29/h4-19,31H,1,20-26H2,2-3H3/t31-,34-/m1/s1 |
| InChIKey | KTBROTISDZRYBA-QIKUIUABSA-N |
| XLogP | 7.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|