C16H14F2O3 — CID 138964659
(2S,3S)-1,2-bis(2-fluorophenyl)-3,4-dihydroxybutan-1-one (PubChem CID 138964659) has the molecular formula C16H14F2O3 and a molecular weight of 292.28 g/mol. Its IUPAC name is (2S,3S)-1,2-bis(2-fluorophenyl)-3,4-dihydroxybutan-1-one.
| Compound Name | (2S,3S)-1,2-bis(2-fluorophenyl)-3,4-dihydroxybutan-1-one |
|---|---|
| PubChem CID | 138964659 |
| Molecular Formula | C16H14F2O3 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (2S,3S)-1,2-bis(2-fluorophenyl)-3,4-dihydroxybutan-1-one |
| SMILES | O=C(c1ccccc1F)[C@@H](c1ccccc1F)[C@H](O)CO |
| InChI | InChI=1S/C16H14F2O3/c17-12-7-3-1-5-10(12)15(14(20)9-19)16(21)11-6-2-4-8-13(11)18/h1-8,14-15,19-20H,9H2/t14-,15+/m1/s1 |
| InChIKey | AYGAFWOQADYIHZ-CABCVRRESA-N |
| XLogP | 2.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |