C33H33NO3 — CID 138964762
3-hydroxy-3-(1-hydroxyhexyl)-1-tritylindol-2-one (PubChem CID 138964762) has the molecular formula C33H33NO3 and a molecular weight of 491.63 g/mol. Its IUPAC name is 3-hydroxy-3-(1-hydroxyhexyl)-1-tritylindol-2-one.
| Compound Name | 3-hydroxy-3-(1-hydroxyhexyl)-1-tritylindol-2-one |
|---|---|
| PubChem CID | 138964762 |
| Molecular Formula | C33H33NO3 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 3-hydroxy-3-(1-hydroxyhexyl)-1-tritylindol-2-one |
| SMILES | CCCCCC(O)C1(O)C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C33H33NO3/c1-2-3-7-24-30(35)33(37)28-22-14-15-23-29(28)34(31(33)36)32(25-16-8-4-9-17-25,26-18-10-5-11-19-26)27-20-12-6-13-21-27/h4-6,8-23,30,35,37H,2-3,7,24H2,1H3 |
| InChIKey | MYVVWCXRQBSUMK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|