C33H30FNO3 — CID 138964955
(3R)-7-fluoro-3-hexanoyl-3-hydroxy-1-tritylindol-2-one (PubChem CID 138964955) has the molecular formula C33H30FNO3 and a molecular weight of 507.61 g/mol. Its IUPAC name is (3R)-7-fluoro-3-hexanoyl-3-hydroxy-1-tritylindol-2-one.
| Compound Name | (3R)-7-fluoro-3-hexanoyl-3-hydroxy-1-tritylindol-2-one |
|---|---|
| PubChem CID | 138964955 |
| Molecular Formula | C33H30FNO3 |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | (3R)-7-fluoro-3-hexanoyl-3-hydroxy-1-tritylindol-2-one |
| SMILES | CCCCCC(=O)[C@@]1(O)C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2c(F)cccc21 |
| InChI | InChI=1S/C33H30FNO3/c1-2-3-7-23-29(36)33(38)27-21-14-22-28(34)30(27)35(31(33)37)32(24-15-8-4-9-16-24,25-17-10-5-11-18-25)26-19-12-6-13-20-26/h4-6,8-22,38H,2-3,7,23H2,1H3/t33-/m1/s1 |
| InChIKey | MYONHTMLSVJGOS-MGBGTMOVSA-N |
| XLogP | 6.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|