C24H16F3NO2 — CID 134955693
(3S)-1-benzyl-3-hydroxy-3-(2-phenylethynyl)-7-(trifluoromethyl)indol-2-one (PubChem CID 134955693) has the molecular formula C24H16F3NO2 and a molecular weight of 407.39 g/mol. Its IUPAC name is (3S)-1-benzyl-3-hydroxy-3-(2-phenylethynyl)-7-(trifluoromethyl)indol-2-one.
| Compound Name | (3S)-1-benzyl-3-hydroxy-3-(2-phenylethynyl)-7-(trifluoromethyl)indol-2-one |
|---|---|
| PubChem CID | 134955693 |
| Molecular Formula | C24H16F3NO2 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (3S)-1-benzyl-3-hydroxy-3-(2-phenylethynyl)-7-(trifluoromethyl)indol-2-one |
| SMILES | O=C1N(Cc2ccccc2)c2c(C(F)(F)F)cccc2[C@@]1(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C24H16F3NO2/c25-24(26,27)20-13-7-12-19-21(20)28(16-18-10-5-2-6-11-18)22(29)23(19,30)15-14-17-8-3-1-4-9-17/h1-13,30H,16H2/t23-/m0/s1 |
| InChIKey | OQVNJABNRYGEGZ-QHCPKHFHSA-N |
| XLogP | 4.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|