C21H23NO3 — CID 2955435
1-benzyl-3-(3,3-dimethyl-2-oxobutyl)-3-hydroxyindol-2-one (PubChem CID 2955435) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-benzyl-3-(3,3-dimethyl-2-oxobutyl)-3-hydroxyindol-2-one.
| Compound Name | 1-benzyl-3-(3,3-dimethyl-2-oxobutyl)-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 2955435 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-benzyl-3-(3,3-dimethyl-2-oxobutyl)-3-hydroxyindol-2-one |
| SMILES | CC(C)(C)C(=O)CC1(O)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H23NO3/c1-20(2,3)18(23)13-21(25)16-11-7-8-12-17(16)22(19(21)24)14-15-9-5-4-6-10-15/h4-12,25H,13-14H2,1-3H3 |
| InChIKey | JLGHIILUKOZHNK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |