C20H26OS — CID 138965292
(3S,4S)-1-phenyl-3-phenylsulfanyloctan-4-ol (PubChem CID 138965292) has the molecular formula C20H26OS and a molecular weight of 314.49 g/mol. Its IUPAC name is (3S,4S)-1-phenyl-3-phenylsulfanyloctan-4-ol.
| Compound Name | (3S,4S)-1-phenyl-3-phenylsulfanyloctan-4-ol |
|---|---|
| PubChem CID | 138965292 |
| Molecular Formula | C20H26OS |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (3S,4S)-1-phenyl-3-phenylsulfanyloctan-4-ol |
| SMILES | CCCC[C@H](O)[C@H](CCc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C20H26OS/c1-2-3-14-19(21)20(22-18-12-8-5-9-13-18)16-15-17-10-6-4-7-11-17/h4-13,19-21H,2-3,14-16H2,1H3/t19-,20-/m0/s1 |
| InChIKey | GEQXUMQLHFMJPE-PMACEKPBSA-N |
| XLogP | 5.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |