C13H21NO — CID 138965519
(1S,2S,4R,5R)-1,2,4,5,6,7-hexamethyl-8-azabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 138965519) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (1S,2S,4R,5R)-1,2,4,5,6,7-hexamethyl-8-azabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,2S,4R,5R)-1,2,4,5,6,7-hexamethyl-8-azabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 138965519 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (1S,2S,4R,5R)-1,2,4,5,6,7-hexamethyl-8-azabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CC1=C(C)[C@@]2(C)N[C@]1(C)[C@@H](C)C(=O)[C@H]2C |
| InChI | InChI=1S/C13H21NO/c1-7-8(2)13(6)10(4)11(15)9(3)12(7,5)14-13/h9-10,14H,1-6H3/t9-,10+,12-,13+ |
| InChIKey | ZRROMANGIDJITM-NIFPGPBJSA-N |
| XLogP | 2.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|