C11H17NO — CID 138965518
(1R,2S,4R,5S)-1,2,4,5-tetramethyl-8-azabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 138965518) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (1R,2S,4R,5S)-1,2,4,5-tetramethyl-8-azabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2S,4R,5S)-1,2,4,5-tetramethyl-8-azabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 138965518 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (1R,2S,4R,5S)-1,2,4,5-tetramethyl-8-azabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C[C@@H]1C(=O)[C@H](C)[C@]2(C)C=C[C@@]1(C)N2 |
| InChI | InChI=1S/C11H17NO/c1-7-9(13)8(2)11(4)6-5-10(7,3)12-11/h5-8,12H,1-4H3/t7-,8+,10-,11+ |
| InChIKey | MSUYOYITTIMNIT-CBZSFBHOSA-N |
| XLogP | 1.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|