C12H19NO3 — CID 162208483
(1R,5S)-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one;methyl acetate (PubChem CID 162208483) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (1R,5S)-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one;methyl acetate.
| Compound Name | (1R,5S)-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one;methyl acetate |
|---|---|
| PubChem CID | 162208483 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (1R,5S)-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one;methyl acetate |
| SMILES | COC(C)=O.C[C@]12C=C[C@](C)(CC(=O)C1)N2 |
| InChI | InChI=1S/C9H13NO.C3H6O2/c1-8-3-4-9(2,10-8)6-7(11)5-8;1-3(4)5-2/h3-4,10H,5-6H2,1-2H3;1-2H3/t8-,9+; |
| InChIKey | ZSNFCNRZYSKQNH-UFIFRZAQSA-N |
| XLogP | 1.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|