C16H21F3O4 — CID 138965631
1-O-ethyl 6-O-(2,2,2-trifluoroethyl) (2Z,4E)-2-cyclohexylhexa-2,4-dienedioate (PubChem CID 138965631) has the molecular formula C16H21F3O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is 1-O-ethyl 6-O-(2,2,2-trifluoroethyl) (2Z,4E)-2-cyclohexylhexa-2,4-dienedioate.
| Compound Name | 1-O-ethyl 6-O-(2,2,2-trifluoroethyl) (2Z,4E)-2-cyclohexylhexa-2,4-dienedioate |
|---|---|
| PubChem CID | 138965631 |
| Molecular Formula | C16H21F3O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-O-ethyl 6-O-(2,2,2-trifluoroethyl) (2Z,4E)-2-cyclohexylhexa-2,4-dienedioate |
| SMILES | CCOC(=O)/C(=C\C=C\C(=O)OCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C16H21F3O4/c1-2-22-15(21)13(12-7-4-3-5-8-12)9-6-10-14(20)23-11-16(17,18)19/h6,9-10,12H,2-5,7-8,11H2,1H3/b10-6+,13-9- |
| InChIKey | FPEBYEVHWXRUCB-ONRCZQTBSA-N |
| XLogP | 3.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|