C16H24OSi — CID 138966025
3,3-di(propan-2-yl)-2-oxa-3-silatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene (PubChem CID 138966025) has the molecular formula C16H24OSi and a molecular weight of 260.45 g/mol. Its IUPAC name is 3,3-di(propan-2-yl)-2-oxa-3-silatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene.
| Compound Name | 3,3-di(propan-2-yl)-2-oxa-3-silatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene |
|---|---|
| PubChem CID | 138966025 |
| Molecular Formula | C16H24OSi |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3,3-di(propan-2-yl)-2-oxa-3-silatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene |
| SMILES | CC(C)[Si]1(C(C)C)Oc2cccc3c2C1CCC3 |
| InChI | InChI=1S/C16H24OSi/c1-11(2)18(12(3)4)15-10-6-8-13-7-5-9-14(17-18)16(13)15/h5,7,9,11-12,15H,6,8,10H2,1-4H3 |
| InChIKey | LIIJACYKLXCHFZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|