C16H16F3NO2 — CID 138966445
N-(3,3,3-trifluoro-1-methoxy-1-naphthalen-2-ylpropyl)acetamide (PubChem CID 138966445) has the molecular formula C16H16F3NO2 and a molecular weight of 311.30 g/mol. Its IUPAC name is N-(3,3,3-trifluoro-1-methoxy-1-naphthalen-2-ylpropyl)acetamide.
| Compound Name | N-(3,3,3-trifluoro-1-methoxy-1-naphthalen-2-ylpropyl)acetamide |
|---|---|
| PubChem CID | 138966445 |
| Molecular Formula | C16H16F3NO2 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-(3,3,3-trifluoro-1-methoxy-1-naphthalen-2-ylpropyl)acetamide |
| SMILES | COC(CC(F)(F)F)(NC(C)=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H16F3NO2/c1-11(21)20-15(22-2,10-16(17,18)19)14-8-7-12-5-3-4-6-13(12)9-14/h3-9H,10H2,1-2H3,(H,20,21) |
| InChIKey | QZZWTCAFJPMDPY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|