C18H19N3O3 — CID 138966562
5-[2-(1H-indol-3-yl)but-3-enyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 138966562) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 5-[2-(1H-indol-3-yl)but-3-enyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[2-(1H-indol-3-yl)but-3-enyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 138966562 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 5-[2-(1H-indol-3-yl)but-3-enyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CC(CC1C(=O)N(C)C(=O)N(C)C1=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H19N3O3/c1-4-11(14-10-19-15-8-6-5-7-12(14)15)9-13-16(22)20(2)18(24)21(3)17(13)23/h4-8,10-11,13,19H,1,9H2,2-3H3 |
| InChIKey | SSLFKINILWEWDI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|