C22H23N3O2 — CID 2380791
(2E)-2-[(2S)-2-(1H-indol-3-yl)-3-nitropropylidene]-1,3,3-trimethylindole (PubChem CID 2380791) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is (2E)-2-[(2S)-2-(1H-indol-3-yl)-3-nitropropylidene]-1,3,3-trimethylindole.
| Compound Name | (2E)-2-[(2S)-2-(1H-indol-3-yl)-3-nitropropylidene]-1,3,3-trimethylindole |
|---|---|
| PubChem CID | 2380791 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (2E)-2-[(2S)-2-(1H-indol-3-yl)-3-nitropropylidene]-1,3,3-trimethylindole |
| SMILES | CN1/C(=C/[C@H](C[N+](=O)[O-])c2c[nH]c3ccccc23)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C22H23N3O2/c1-22(2)18-9-5-7-11-20(18)24(3)21(22)12-15(14-25(26)27)17-13-23-19-10-6-4-8-16(17)19/h4-13,15,23H,14H2,1-3H3/b21-12+/t15-/m1/s1 |
| InChIKey | KVBFEQLMPLBWDO-VRCTWVPOSA-N |
| XLogP | 4.84 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|