C26H36O7 — CID 138967033
(1R,3E,7S,9S,12E,14R,15R)-9-hydroxy-7-[(E,2S,3R)-6-hydroxy-3-methoxy-4-methylhex-4-en-2-yl]-14-methyl-6,16-dioxabicyclo[13.3.1]nonadeca-3,12-dien-10-yne-5,17-dione (PubChem CID 138967033) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is (1R,3E,7S,9S,12E,14R,15R)-9-hydroxy-7-[(E,2S,3R)-6-hydroxy-3-methoxy-4-methylhex-4-en-2-yl]-14-methyl-6,16-dioxabicyclo[13.3.1]nonadeca-3,12-dien-10-yne-5,17-dione.
| Compound Name | (1R,3E,7S,9S,12E,14R,15R)-9-hydroxy-7-[(E,2S,3R)-6-hydroxy-3-methoxy-4-methylhex-4-en-2-yl]-14-methyl-6,16-dioxabicyclo[13.3.1]nonadeca-3,12-dien-10-yne-5,17-dione |
|---|---|
| PubChem CID | 138967033 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | (1R,3E,7S,9S,12E,14R,15R)-9-hydroxy-7-[(E,2S,3R)-6-hydroxy-3-methoxy-4-methylhex-4-en-2-yl]-14-methyl-6,16-dioxabicyclo[13.3.1]nonadeca-3,12-dien-10-yne-5,17-dione |
| SMILES | CO[C@@H](/C(C)=C/CO)[C@@H](C)[C@@H]1C[C@H](O)C#C/C=C/[C@@H](C)[C@H]2C[C@@H](C/C=C/C(=O)O1)CC(=O)O2 |
| InChI | InChI=1S/C26H36O7/c1-17-8-5-6-10-21(28)16-23(19(3)26(31-4)18(2)12-13-27)33-24(29)11-7-9-20-14-22(17)32-25(30)15-20/h5,7-8,11-12,17,19-23,26-28H,9,13-16H2,1-4H3/b8-5+,11-7+,18-12+/t17-,19+,20-,21-,22-,23+,26+/m1/s1 |
| InChIKey | NTODPSPWYURHAK-ICIWIJLISA-N |
| XLogP | 2.72 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|