C27H27NO4 — CID 138967078
tert-butyl (E)-3-(1-methoxy-8-methyl-3-phenyl-1H-pyrano[4,3-b]quinolin-4-yl)prop-2-enoate (PubChem CID 138967078) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is tert-butyl (E)-3-(1-methoxy-8-methyl-3-phenyl-1H-pyrano[4,3-b]quinolin-4-yl)prop-2-enoate.
| Compound Name | tert-butyl (E)-3-(1-methoxy-8-methyl-3-phenyl-1H-pyrano[4,3-b]quinolin-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 138967078 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | tert-butyl (E)-3-(1-methoxy-8-methyl-3-phenyl-1H-pyrano[4,3-b]quinolin-4-yl)prop-2-enoate |
| SMILES | COC1OC(c2ccccc2)=C(/C=C/C(=O)OC(C)(C)C)c2nc3ccc(C)cc3cc21 |
| InChI | InChI=1S/C27H27NO4/c1-17-11-13-22-19(15-17)16-21-24(28-22)20(12-14-23(29)32-27(2,3)4)25(31-26(21)30-5)18-9-7-6-8-10-18/h6-16,26H,1-5H3/b14-12+ |
| InChIKey | DHEXSKKWPSMHSP-WYMLVPIESA-N |
| XLogP | 5.98 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|