C18H30N2O4 — CID 138967219
tert-butyl (2S)-2-[4-(hydroxymethyl)hepta-1,6-dien-4-ylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 138967219) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-(hydroxymethyl)hepta-1,6-dien-4-ylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[4-(hydroxymethyl)hepta-1,6-dien-4-ylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 138967219 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | tert-butyl (2S)-2-[4-(hydroxymethyl)hepta-1,6-dien-4-ylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCC(CO)(CC=C)NC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30N2O4/c1-6-10-18(13-21,11-7-2)19-15(22)14-9-8-12-20(14)16(23)24-17(3,4)5/h6-7,14,21H,1-2,8-13H2,3-5H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | RJZMAEATUKCMQV-AWEZNQCLSA-N |
| XLogP | 2.39 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|