C16H26N2O5 — CID 10336499
tert-butyl (2R)-2-[(2-methoxy-2-oxoethyl)carbamoyl]-2-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 10336499) has the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2-methoxy-2-oxoethyl)carbamoyl]-2-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(2-methoxy-2-oxoethyl)carbamoyl]-2-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10336499 |
| Molecular Formula | C16H26N2O5 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | tert-butyl (2R)-2-[(2-methoxy-2-oxoethyl)carbamoyl]-2-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@]1(C(=O)NCC(=O)OC)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26N2O5/c1-6-8-16(13(20)17-11-12(19)22-5)9-7-10-18(16)14(21)23-15(2,3)4/h6H,1,7-11H2,2-5H3,(H,17,20)/t16-/m0/s1 |
| InChIKey | ZDHZVCFHBJZKIC-INIZCTEOSA-N |
| XLogP | 1.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|